Products 100726-70-3
CAS 100726-70-3 is the registry number for Ethyl 3-(2,4-dichlorophenyl)-5-methylisoxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 100726-70-3) is a chemical compound with the molecular formula C13H11Cl2NO3 and a molecular weight of 300.13 g/mol. IUPAC name: ethyl 3-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: ZHCBIDQBOIVNOQ-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO3 |
|---|---|
| Molecular weight | 300.13 g/mol |
| IUPAC name | ethyl 3-(2,4-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | ZHCBIDQBOIVNOQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(ON=C1C2=C(C=C(C=C2)Cl)Cl)C |
Computed by PubChem (NCBI)