CAS 774605-57-1 appears in our catalog under these names: 3-(2,6-Dichlorophenyl)-5-propyl-1,2-oxazole-4-carboxylic acid, 95%, 3-(2,6-Dichlorophenyl)-5-propyl-1,2-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(2,6-dichlorophenyl)-5-propyl-1,2-oxazole-4-carboxylic acid (CAS 774605-57-1) is a chemical compound with the molecular formula C13H11Cl2NO3 and a molecular weight of 300.13 g/mol. IUPAC name: 3-(2,6-dichlorophenyl)-5-propyl-1,2-oxazole-4-carboxylic acid. InChIKey: LNPRSLPLJGGYGI-UHFFFAOYSA-N.
| Molecular formula | C13H11Cl2NO3 |
|---|---|
| Molecular weight | 300.13 g/mol |
| IUPAC name | 3-(2,6-dichlorophenyl)-5-propyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | LNPRSLPLJGGYGI-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)