CAS 1007464-61-0 is the registry number for 2-Methyl-3-(trimethyl-1H-pyrazol-4-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid (CAS 1007464-61-0) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid. InChIKey: SYZXDAOTZRWAOH-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 2-methyl-3-(1,3,5-trimethylpyrazol-4-yl)propanoic acid |
| InChIKey | SYZXDAOTZRWAOH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)CC(C)C(=O)O |
Computed by PubChem (NCBI)