Products 1007502-22-8
CAS 1007502-22-8 is the registry number for Methyl 2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetate (CAS 1007502-22-8) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: methyl 2-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetate. InChIKey: IDKCAZDMSUSXAQ-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | methyl 2-(1-ethyl-3,5-dimethylpyrazol-4-yl)acetate |
| InChIKey | IDKCAZDMSUSXAQ-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)CC(=O)OC)C |
Computed by PubChem (NCBI)