Products 100763-74-4
CAS 100763-74-4 is the registry number for 4-Chloro-6-(3,4-dimethylphenoxy)-2-pyrimidinamine, ≥96%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
4-chloro-6-(3,4-dimethylphenoxy)pyrimidin-2-amine (CAS 100763-74-4) is a chemical compound with the molecular formula C12H12ClN3O and a molecular weight of 249.69 g/mol. IUPAC name: 4-chloro-6-(3,4-dimethylphenoxy)pyrimidin-2-amine. InChIKey: LHNFETCGLQFWPF-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | 4-chloro-6-(3,4-dimethylphenoxy)pyrimidin-2-amine |
| InChIKey | LHNFETCGLQFWPF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=CC(=NC(=N2)N)Cl)C |
Computed by PubChem (NCBI)