Products 1007884-62-9
CAS 1007884-62-9 is the registry number for (2S)-2-[(Dimethylcarbamoyl)amino]-3-methylbutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2S)-2-(dimethylcarbamoylamino)-3-methylbutanoic acid (CAS 1007884-62-9) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: (2S)-2-(dimethylcarbamoylamino)-3-methylbutanoic acid. InChIKey: QXFZOJHYVBKGDH-LURJTMIESA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-(dimethylcarbamoylamino)-3-methylbutanoic acid |
| InChIKey | QXFZOJHYVBKGDH-LURJTMIESA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)N(C)C |
Computed by PubChem (NCBI)