CAS 857722-65-7 is the registry number for Methyl (2r)-2-(2-aminoacetamido)-3-methylbutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl (2R)-2-[(2-aminoacetyl)amino]-3-methylbutanoate (CAS 857722-65-7) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: methyl (2R)-2-[(2-aminoacetyl)amino]-3-methylbutanoate. InChIKey: PIYGLVXTSVUKQN-SSDOTTSWSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | methyl (2R)-2-[(2-aminoacetyl)amino]-3-methylbutanoate |
| InChIKey | PIYGLVXTSVUKQN-SSDOTTSWSA-N |
| SMILES | CC(C)[C@H](C(=O)OC)NC(=O)CN |
Computed by PubChem (NCBI)