CAS 1007962-28-8 appears in our catalog under these names: 1-(2-Fluorobenzenesulfonyl)pyrrolidine-2-carboxylic acid, 95%, 1–(2–Fluorobenzenesulfonyl)pyrrolidine–2–carboxylic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 10g, 100mg, 1g, 250mg.
1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 1007962-28-8) is a chemical compound with the molecular formula C11H12FNO4S and a molecular weight of 273.28 g/mol. IUPAC name: 1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: MMRFYVHZNFNROR-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4S |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 1-(2-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | MMRFYVHZNFNROR-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)S(=O)(=O)C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)