CAS 910481-87-7 appears in our catalog under these names: 1-[(4-Fluorophenyl)sulfonyl]proline, 95%, 1-[(4-Fluorophenyl)sulfonyl]-2-pyrrolidinecarboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 25g, 10g, 1g.
1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 910481-87-7) is a chemical compound with the molecular formula C11H12FNO4S and a molecular weight of 273.28 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: ISYUAFVYETYRPO-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4S |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | ISYUAFVYETYRPO-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)S(=O)(=O)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)