CAS 1007975-25-8 is the registry number for Sodium 1-(1,1-dioxidotetrahydrothiophen-3-yl)piperidine-4-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylate (CAS 1007975-25-8) is a chemical compound with the molecular formula C10H16NO4S- and a molecular weight of 246.31 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylate. InChIKey: LZGSJQNRMQTUOM-UHFFFAOYSA-M.
| Molecular formula | C10H16NO4S- |
|---|---|
| Molecular weight | 246.31 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylate |
| InChIKey | LZGSJQNRMQTUOM-UHFFFAOYSA-M |
| SMILES | C1CN(CCC1C(=O)[O-])C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)