Products 900641-11-4

CAS 900641-11-4 is the registry number for 1-(1,1-Dioxidotetrahydro-3-thienyl)-4-piperidinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid (CAS 900641-11-4) is a chemical compound with the molecular formula C10H17NO4S and a molecular weight of 247.31 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid. InChIKey: LZGSJQNRMQTUOM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17NO4S
Molecular weight247.31 g/mol
IUPAC name1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid
InChIKeyLZGSJQNRMQTUOM-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)C2CCS(=O)(=O)C2

Computed by PubChem (NCBI)