CAS 900641-11-4 is the registry number for 1-(1,1-Dioxidotetrahydro-3-thienyl)-4-piperidinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid (CAS 900641-11-4) is a chemical compound with the molecular formula C10H17NO4S and a molecular weight of 247.31 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid. InChIKey: LZGSJQNRMQTUOM-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)piperidine-4-carboxylic acid |
| InChIKey | LZGSJQNRMQTUOM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)