CAS 1008050-81-4 appears in our catalog under these names: 2-([(2,6-Dichlorophenyl)sulfonyl]amino)propanoic acid, 95%, 2–(2,6–Dichlorobenzenesulfonamido)propanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid (CAS 1008050-81-4) is a chemical compound with the molecular formula C9H9Cl2NO4S and a molecular weight of 298.14 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid. InChIKey: PAUBDKVONJBMDJ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO4S |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid |
| InChIKey | PAUBDKVONJBMDJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)