CAS 612042-78-1 appears in our catalog under these names: 3-([(2,6-Dichlorophenyl)sulfonyl]amino)propanoic acid, 95%, 3-(2,6-Dichlorophenylsulfonamido)propanoic acid, 97%, 3-((2,6-Dichlorophenyl)sulfonamido)propanoic acid, 95%, 95%, 3-{[(2,6-dichlorophenyl)sulfonyl]amino}propanoic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 500mg.
3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid (CAS 612042-78-1) is a chemical compound with the molecular formula C9H9Cl2NO4S and a molecular weight of 298.14 g/mol. IUPAC name: 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid. InChIKey: ALZFPJUXLAZZRV-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO4S |
|---|---|
| Molecular weight | 298.14 g/mol |
| IUPAC name | 3-[(2,6-dichlorophenyl)sulfonylamino]propanoic acid |
| InChIKey | ALZFPJUXLAZZRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)NCCC(=O)O)Cl |
Computed by PubChem (NCBI)