Products 1008119-09-2
CAS 1008119-09-2 appears in our catalog under these names: 4-Acetyl-N,N-dimethylbenzamide, 4-Acetyl-N,N-dimethylbenzamide 98%, 4-Acetyl-N,N-dimethylbenzamide, 98%, 98%, 4-Acetyl-N,N-dimethylbenzamide, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g.
4-acetyl-N,N-dimethylbenzamide (CAS 1008119-09-2) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 4-acetyl-N,N-dimethylbenzamide. InChIKey: KADXGLUHGAXACG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 4-acetyl-N,N-dimethylbenzamide |
| InChIKey | KADXGLUHGAXACG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)N(C)C |
Computed by PubChem (NCBI)