CAS 1008187-54-9 appears in our catalog under these names: 2-(4-(Acetamidomethyl)benzenesulfonamido)-3-methylbutanoic acid, 95%, 2-(4-(Acetamidomethyl)benzenesulfonamido)-3-methylbutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[[4-(acetamidomethyl)phenyl]sulfonylamino]-3-methylbutanoic acid (CAS 1008187-54-9) is a chemical compound with the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. IUPAC name: 2-[[4-(acetamidomethyl)phenyl]sulfonylamino]-3-methylbutanoic acid. InChIKey: UIMYHFOCFBFYJN-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O5S |
|---|---|
| Molecular weight | 328.39 g/mol |
| IUPAC name | 2-[[4-(acetamidomethyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
| InChIKey | UIMYHFOCFBFYJN-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NS(=O)(=O)C1=CC=C(C=C1)CNC(=O)C |
Computed by PubChem (NCBI)