Products 1203428-58-3

CAS 1203428-58-3 is the registry number for 4-Methoxy-3-(N-(2-(pyrrolidin-1-yl)ethyl)sulfamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-methoxy-3-(2-pyrrolidin-1-ylethylsulfamoyl)benzoic acid (CAS 1203428-58-3) is a chemical compound with the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. IUPAC name: 4-methoxy-3-(2-pyrrolidin-1-ylethylsulfamoyl)benzoic acid. InChIKey: BYRGOEAWHVWJKK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20N2O5S
Molecular weight328.39 g/mol
IUPAC name4-methoxy-3-(2-pyrrolidin-1-ylethylsulfamoyl)benzoic acid
InChIKeyBYRGOEAWHVWJKK-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)NCCN2CCCC2

Computed by PubChem (NCBI)