Products 100849-37-4
CAS 100849-37-4 appears in our catalog under these names: Aniline-13C6, >95% (HPLC), Aniline–13C6, Aniline-13C6, ANILINE-13C6, 99 ATOM % 13C. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 250mg, 25mg, 1g, 100mg, 500mg, 0,025g, 0,01g, 0,05g.
(1,2,3,4,5,6-13C6)cyclohexatrienamine (CAS 100849-37-4) is a chemical compound with the molecular formula C6H7N and a molecular weight of 99.083 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatrienamine. InChIKey: PAYRUJLWNCNPSJ-IDEBNGHGSA-N.
| Molecular formula | C6H7N |
|---|---|
| Molecular weight | 99.083 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatrienamine |
| InChIKey | PAYRUJLWNCNPSJ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)N |
Computed by PubChem (NCBI)