Products 14545-23-4
CAS 14545-23-4 appears in our catalog under these names: Aniline-d7, 98 atom % D, min 98% Chemical Purity, Aniline–d?, Aniline-D7 98 atom % D, ANILINE-D7, 98 ATOM % D. Offered by: CDN, GLPBio, Deutero, Sigma-Aldrich. Available pack sizes: 1g, 5g, 0,7ml, 5ml.
N,N,2,3,4,5,6-heptadeuterioaniline (CAS 14545-23-4) is a chemical compound with the molecular formula C6H7N and a molecular weight of 100.17 g/mol. IUPAC name: N,N,2,3,4,5,6-heptadeuterioaniline. InChIKey: PAYRUJLWNCNPSJ-LQHBDRBESA-N.
| Molecular formula | C6H7N |
|---|---|
| Molecular weight | 100.17 g/mol |
| IUPAC name | N,N,2,3,4,5,6-heptadeuterioaniline |
| InChIKey | PAYRUJLWNCNPSJ-LQHBDRBESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)