CAS 1008774-63-7 appears in our catalog under these names: 1-((3-Phenyl-1,2-oxazol-5-yl)methyl)piperazine dihydrochloride, 95%, 1-((3-Phenyl-1,2-oxazol-5-yl)methyl)piperazine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-phenyl-5-(piperazin-1-ylmethyl)-1,2-oxazole;dihydrochloride (CAS 1008774-63-7) is a chemical compound with the molecular formula C14H19Cl2N3O and a molecular weight of 316.2 g/mol. IUPAC name: 3-phenyl-5-(piperazin-1-ylmethyl)-1,2-oxazole;dihydrochloride. InChIKey: KKABIYCUSWQOCT-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | 3-phenyl-5-(piperazin-1-ylmethyl)-1,2-oxazole;dihydrochloride |
| InChIKey | KKABIYCUSWQOCT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC(=NO2)C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)