CAS 1177346-18-7 appears in our catalog under these names: 1-((2-Phenyl-1,3-oxazol-4-yl)methyl)piperazine dihydrochloride, 95%, 1-((2-Phenyl-1,3-oxazol-4-yl)methyl)piperazine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-phenyl-4-(piperazin-1-ylmethyl)-1,3-oxazole;dihydrochloride (CAS 1177346-18-7) is a chemical compound with the molecular formula C14H19Cl2N3O and a molecular weight of 316.2 g/mol. IUPAC name: 2-phenyl-4-(piperazin-1-ylmethyl)-1,3-oxazole;dihydrochloride. InChIKey: YDAGMBPDWLOSGE-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | 2-phenyl-4-(piperazin-1-ylmethyl)-1,3-oxazole;dihydrochloride |
| InChIKey | YDAGMBPDWLOSGE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=COC(=N2)C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)