CAS 1009003-67-1 appears in our catalog under these names: 2-([(2,6-Dichlorophenyl)sulfonyl]amino)-4-methylpentanoic acid, 95%, 2-(2,6-Dichlorobenzenesulfonamido)-4-methylpentanoic acid, 95%, 2–(2,6–Dichlorobenzenesulfonamido)–4–methylpentanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[(2,6-dichlorophenyl)sulfonylamino]-4-methylpentanoic acid (CAS 1009003-67-1) is a chemical compound with the molecular formula C12H15Cl2NO4S and a molecular weight of 340.2 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)sulfonylamino]-4-methylpentanoic acid. InChIKey: ZGTSGKVKLXVHQP-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO4S |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)sulfonylamino]-4-methylpentanoic acid |
| InChIKey | ZGTSGKVKLXVHQP-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NS(=O)(=O)C1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)