Products 743451-65-2

CAS 743451-65-2 appears in our catalog under these names: 2,4-Dichloro-5-([(1-methylbutyl)amino]sulfonyl)benzoic acid, 95%, 2,4-Dichloro-5-((pentan-2-yl)sulfamoyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-(pentan-2-ylsulfamoyl)benzoic acid (CAS 743451-65-2) is a chemical compound with the molecular formula C12H15Cl2NO4S and a molecular weight of 340.2 g/mol. IUPAC name: 2,4-dichloro-5-(pentan-2-ylsulfamoyl)benzoic acid. InChIKey: SZYQKZSPWPXWMK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15Cl2NO4S
Molecular weight340.2 g/mol
IUPAC name2,4-dichloro-5-(pentan-2-ylsulfamoyl)benzoic acid
InChIKeySZYQKZSPWPXWMK-UHFFFAOYSA-N
SMILESCCCC(C)NS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)