CAS 1009306-59-5 is the registry number for 4-Chloro-9-methyl-1,2,3,4-tetrahydroacridine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-9-methyl-1,2,3,4-tetrahydroacridine;hydrochloride (CAS 1009306-59-5) is a chemical compound with the molecular formula C14H15Cl2N and a molecular weight of 268.2 g/mol. IUPAC name: 4-chloro-9-methyl-1,2,3,4-tetrahydroacridine;hydrochloride. InChIKey: PPKAWGXDZHGYHL-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 4-chloro-9-methyl-1,2,3,4-tetrahydroacridine;hydrochloride |
| InChIKey | PPKAWGXDZHGYHL-UHFFFAOYSA-N |
| SMILES | CC1=C2CCCC(C2=NC3=CC=CC=C13)Cl.Cl |
Computed by PubChem (NCBI)