CAS 21998-50-5 appears in our catalog under these names: 2-(4-Chlorophenyl)-2-phenylethanamine hydrochloride, 98%, 2-(4-Chlorophenyl)-2-Phenylethylamine hydrochloride, 2-(4-Chlorophenyl)-2-phenylethylamine, HCl, 98%, 2-(4-CHLOROPHENYL)-2-PHENYLETHYLAMINE HCL, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 50mg, 250mg.
2-(4-chlorophenyl)-2-phenylethanamine;hydrochloride (CAS 21998-50-5) is a chemical compound with the molecular formula C14H15Cl2N and a molecular weight of 268.2 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-phenylethanamine;hydrochloride. InChIKey: KYGYPNIZCSHFEW-UHFFFAOYSA-N.
| Molecular formula | C14H15Cl2N |
|---|---|
| Molecular weight | 268.2 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-phenylethanamine;hydrochloride |
| InChIKey | KYGYPNIZCSHFEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)