Products 212576-02-8

CAS 212576-02-8 is the registry number for 2-Amino-2-cyclohexylacetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-2-cyclohexylacetic acid;hydrochloride (CAS 212576-02-8) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: 2-amino-2-cyclohexylacetic acid;hydrochloride. InChIKey: QMUIOFNZAZPFFT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC name2-amino-2-cyclohexylacetic acid;hydrochloride
InChIKeyQMUIOFNZAZPFFT-UHFFFAOYSA-N
SMILESC1CCC(CC1)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)