CAS 1009540-53-7 is the registry number for 2-{(4-(dimethylsulfamoyl)phenyl)formamido}-4-methylpentanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[[4-(dimethylsulfamoyl)benzoyl]amino]-4-methylpentanoic acid (CAS 1009540-53-7) is a chemical compound with the molecular formula C15H22N2O5S and a molecular weight of 342.4 g/mol. IUPAC name: 2-[[4-(dimethylsulfamoyl)benzoyl]amino]-4-methylpentanoic acid. InChIKey: REYIJKFOYHUVPX-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O5S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 2-[[4-(dimethylsulfamoyl)benzoyl]amino]-4-methylpentanoic acid |
| InChIKey | REYIJKFOYHUVPX-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)NC(=O)C1=CC=C(C=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)