Products 794554-68-0
CAS 794554-68-0 appears in our catalog under these names: 5-[(Diethylamino)sulfonyl]-2-morpholin-4-ylbenzoic acid, 95%, 5-(Diethylsulfamoyl)-2-(morpholin-4-yl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
5-(diethylsulfamoyl)-2-morpholin-4-ylbenzoic acid (CAS 794554-68-0) is a chemical compound with the molecular formula C15H22N2O5S and a molecular weight of 342.4 g/mol. IUPAC name: 5-(diethylsulfamoyl)-2-morpholin-4-ylbenzoic acid. InChIKey: VUCMZJWEELKWJY-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O5S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 5-(diethylsulfamoyl)-2-morpholin-4-ylbenzoic acid |
| InChIKey | VUCMZJWEELKWJY-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)N2CCOCC2)C(=O)O |
Computed by PubChem (NCBI)