CAS 1009548-97-3 is the registry number for 2-(Adamantan-1-yl)-2-(4-(propan-2-yl)benzenesulfonamido)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(1-adamantyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]acetic acid (CAS 1009548-97-3) is a chemical compound with the molecular formula C21H29NO4S and a molecular weight of 391.5 g/mol. IUPAC name: 2-(1-adamantyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]acetic acid. InChIKey: NVHWFSUIZAQYPP-UHFFFAOYSA-N.
| Molecular formula | C21H29NO4S |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | 2-(1-adamantyl)-2-[(4-propan-2-ylphenyl)sulfonylamino]acetic acid |
| InChIKey | NVHWFSUIZAQYPP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)S(=O)(=O)NC(C(=O)O)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)