CAS 1009595-18-9 appears in our catalog under these names: N-(2,3,5,6-Tetramethylphenylsulfonyl)-l-valine monohydrate, 95%, 3–Methyl–2–(2,3,5,6–tetramethylbenzenesulfonamido)butanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2S)-3-methyl-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid (CAS 1009595-18-9) is a chemical compound with the molecular formula C15H23NO4S and a molecular weight of 313.4 g/mol. IUPAC name: (2S)-3-methyl-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid. InChIKey: FSSJWNVCOOWYHL-ZDUSSCGKSA-N.
| Molecular formula | C15H23NO4S |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | (2S)-3-methyl-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]butanoic acid |
| InChIKey | FSSJWNVCOOWYHL-ZDUSSCGKSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)N[C@@H](C(C)C)C(=O)O)C)C |
Computed by PubChem (NCBI)