Products 735297-18-4

CAS 735297-18-4 is the registry number for 4-(5-tert-Butyl-2-methylbenzenesulfonamido)butanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]butanoic acid (CAS 735297-18-4) is a chemical compound with the molecular formula C15H23NO4S and a molecular weight of 313.4 g/mol. IUPAC name: 4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]butanoic acid. InChIKey: XUNXKZAKYDYDSX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23NO4S
Molecular weight313.4 g/mol
IUPAC name4-[(5-tert-butyl-2-methylphenyl)sulfonylamino]butanoic acid
InChIKeyXUNXKZAKYDYDSX-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(C)(C)C)S(=O)(=O)NCCCC(=O)O

Computed by PubChem (NCBI)