CAS 100960-90-5 is the registry number for 2,5-Dimethylpyridine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,5-dimethylpyridine-3-carboxylic acid;hydrochloride (CAS 100960-90-5) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 2,5-dimethylpyridine-3-carboxylic acid;hydrochloride. InChIKey: YLTLCVOWPCZSNS-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 2,5-dimethylpyridine-3-carboxylic acid;hydrochloride |
| InChIKey | YLTLCVOWPCZSNS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)C)C(=O)O.Cl |
Computed by PubChem (NCBI)