Products 100960-90-5

CAS 100960-90-5 is the registry number for 2,5-Dimethylpyridine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2,5-dimethylpyridine-3-carboxylic acid;hydrochloride (CAS 100960-90-5) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 2,5-dimethylpyridine-3-carboxylic acid;hydrochloride. InChIKey: YLTLCVOWPCZSNS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClNO2
Molecular weight187.62 g/mol
IUPAC name2,5-dimethylpyridine-3-carboxylic acid;hydrochloride
InChIKeyYLTLCVOWPCZSNS-UHFFFAOYSA-N
SMILESCC1=CC(=C(N=C1)C)C(=O)O.Cl

Computed by PubChem (NCBI)