Products 100960-91-6
CAS 100960-91-6 appears in our catalog under these names: 2,6-Dimethyl-nicotinic acid hydrochloride, 95%, 2,6-Dimethyl-nicotinic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
2,6-dimethylpyridine-3-carboxylic acid;hydrochloride (CAS 100960-91-6) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 2,6-dimethylpyridine-3-carboxylic acid;hydrochloride. InChIKey: PELPCJCHRYHXBE-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 2,6-dimethylpyridine-3-carboxylic acid;hydrochloride |
| InChIKey | PELPCJCHRYHXBE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)C(=O)O)C.Cl |
Computed by PubChem (NCBI)