Products 1009621-74-2
CAS 1009621-74-2 is the registry number for 1-(3-Bromopropoxy)-2,3-dichlorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(3-bromopropoxy)-2,3-dichlorobenzene (CAS 1009621-74-2) is a chemical compound with the molecular formula C9H9BrCl2O and a molecular weight of 283.97 g/mol. IUPAC name: 1-(3-bromopropoxy)-2,3-dichlorobenzene. InChIKey: PGDRZNLNYRDQTP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrCl2O |
|---|---|
| Molecular weight | 283.97 g/mol |
| IUPAC name | 1-(3-bromopropoxy)-2,3-dichlorobenzene |
| InChIKey | PGDRZNLNYRDQTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OCCCBr |
Computed by PubChem (NCBI)