Products 2734778-59-5
CAS 2734778-59-5 is the registry number for 2-Bromo-α-(dichloromethyl)-5-methylbenzenemethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(2-bromo-5-methylphenyl)-2,2-dichloroethanol (CAS 2734778-59-5) is a chemical compound with the molecular formula C9H9BrCl2O and a molecular weight of 283.97 g/mol. IUPAC name: 1-(2-bromo-5-methylphenyl)-2,2-dichloroethanol. InChIKey: UVAWNMNGWFTKPD-UHFFFAOYSA-N.
| Molecular formula | C9H9BrCl2O |
|---|---|
| Molecular weight | 283.97 g/mol |
| IUPAC name | 1-(2-bromo-5-methylphenyl)-2,2-dichloroethanol |
| InChIKey | UVAWNMNGWFTKPD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Br)C(C(Cl)Cl)O |
Computed by PubChem (NCBI)