Products 100973-09-9

CAS 100973-09-9 is the registry number for 3-(3,4,5-Trimethoxyphenyl)pentanedioic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(3,4,5-trimethoxyphenyl)pentanedioic acid (CAS 100973-09-9) is a chemical compound with the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. IUPAC name: 3-(3,4,5-trimethoxyphenyl)pentanedioic acid. InChIKey: XLJDNPGZFKBWJE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O7
Molecular weight298.29 g/mol
IUPAC name3-(3,4,5-trimethoxyphenyl)pentanedioic acid
InChIKeyXLJDNPGZFKBWJE-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C(CC(=O)O)CC(=O)O

Computed by PubChem (NCBI)