Products 25293-64-5

CAS 25293-64-5 is the registry number for Bis(oxiran-2-ylmethyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate. Offered by: Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 500g.

Structural formula: {0} (CAS {1})

Bis(oxiran-2-ylmethyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate (CAS 25293-64-5) is a chemical compound with the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. IUPAC name: bis(oxiran-2-ylmethyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate. InChIKey: ITZGNPZZAICLKA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O7
Molecular weight298.29 g/mol
IUPAC namebis(oxiran-2-ylmethyl) 7-oxabicyclo[4.1.0]heptane-3,4-dicarboxylate
InChIKeyITZGNPZZAICLKA-UHFFFAOYSA-N
SMILESC1C(C(CC2C1O2)C(=O)OCC3CO3)C(=O)OCC4CO4

Computed by PubChem (NCBI)