CAS 100981-68-8 is the registry number for Ethyl N-((p-bromophenyl)sulfonyl)formimidate. Offered by: TRC. Available pack sizes: 500mg.
Ethyl N-(4-bromophenyl)sulfonylmethanimidate (CAS 100981-68-8) is a chemical compound with the molecular formula C9H10BrNO3S and a molecular weight of 292.15 g/mol. IUPAC name: ethyl N-(4-bromophenyl)sulfonylmethanimidate. InChIKey: ZWIQWKIKBWWGKZ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3S |
|---|---|
| Molecular weight | 292.15 g/mol |
| IUPAC name | ethyl N-(4-bromophenyl)sulfonylmethanimidate |
| InChIKey | ZWIQWKIKBWWGKZ-UHFFFAOYSA-N |
| SMILES | CCOC=NS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)