Products 99847-74-2
CAS 99847-74-2 is the registry number for 4-(2-Bromoacetyl)-N-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-(2-bromoacetyl)-N-methylbenzenesulfonamide (CAS 99847-74-2) is a chemical compound with the molecular formula C9H10BrNO3S and a molecular weight of 292.15 g/mol. IUPAC name: 4-(2-bromoacetyl)-N-methylbenzenesulfonamide. InChIKey: UCOFLLDXKSXDLH-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3S |
|---|---|
| Molecular weight | 292.15 g/mol |
| IUPAC name | 4-(2-bromoacetyl)-N-methylbenzenesulfonamide |
| InChIKey | UCOFLLDXKSXDLH-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)