CAS 1010129-39-1 is the registry number for Poly(9,9-dihexylfluorenyl-2,7-diyl) end capped with dimethylphenyl. Offered by: Lumtec. Available pack sizes: On request.
3-(2-chlorophenyl)-N-(2,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (CAS 1010129-39-1) is a chemical compound with the molecular formula C17H11Cl3N2O2 and a molecular weight of 381.6 g/mol. IUPAC name: 3-(2-chlorophenyl)-N-(2,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide. InChIKey: SEKRPJSPFULZMU-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl3N2O2 |
|---|---|
| Molecular weight | 381.6 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-N-(2,5-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| InChIKey | SEKRPJSPFULZMU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)NC3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)