Products 318256-25-6
CAS 318256-25-6 is the registry number for Methyl 5-(2-chlorophenyl)-1-(3,4-dichlorophenyl)-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
Methyl 5-(2-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazole-3-carboxylate (CAS 318256-25-6) is a chemical compound with the molecular formula C17H11Cl3N2O2 and a molecular weight of 381.6 g/mol. IUPAC name: methyl 5-(2-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazole-3-carboxylate. InChIKey: IVYXCPQXNVVNKQ-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl3N2O2 |
|---|---|
| Molecular weight | 381.6 g/mol |
| IUPAC name | methyl 5-(2-chlorophenyl)-1-(3,4-dichlorophenyl)pyrazole-3-carboxylate |
| InChIKey | IVYXCPQXNVVNKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C(=C1)C2=CC=CC=C2Cl)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)