Products 1010422-41-9
CAS 1010422-41-9 is the registry number for N-(3-Bromophenethyl)-2,2-difluoroacetamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[2-(3-bromophenyl)ethyl]-2,2-difluoroacetamide (CAS 1010422-41-9) is a chemical compound with the molecular formula C10H10BrF2NO and a molecular weight of 278.09 g/mol. IUPAC name: N-[2-(3-bromophenyl)ethyl]-2,2-difluoroacetamide. InChIKey: ILFYTESAGFYKFP-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2NO |
|---|---|
| Molecular weight | 278.09 g/mol |
| IUPAC name | N-[2-(3-bromophenyl)ethyl]-2,2-difluoroacetamide |
| InChIKey | ILFYTESAGFYKFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CCNC(=O)C(F)F |
Computed by PubChem (NCBI)