CAS 1119452-44-6 is the registry number for 2-Bromo-n-(2,5-difluorophenyl)butanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N-(2,5-difluorophenyl)butanamide (CAS 1119452-44-6) is a chemical compound with the molecular formula C10H10BrF2NO and a molecular weight of 278.09 g/mol. IUPAC name: 2-bromo-N-(2,5-difluorophenyl)butanamide. InChIKey: GYSGKGJEUKIUAZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF2NO |
|---|---|
| Molecular weight | 278.09 g/mol |
| IUPAC name | 2-bromo-N-(2,5-difluorophenyl)butanamide |
| InChIKey | GYSGKGJEUKIUAZ-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)NC1=C(C=CC(=C1)F)F)Br |
Computed by PubChem (NCBI)