CAS 101071-96-9 appears in our catalog under these names: 8-Bromo-7-ethyl-3,7-dihydro-3-methyl-1H-purine-2,6-dione, 8-Bromo-7-ethyl-3,7-dihydro-3-methyl-1H-purine-2,6-dione-d5. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.
8-bromo-7-ethyl-3-methylpurine-2,6-dione (CAS 101071-96-9) is a chemical compound with the molecular formula C8H9BrN4O2 and a molecular weight of 273.09 g/mol. IUPAC name: 8-bromo-7-ethyl-3-methylpurine-2,6-dione. InChIKey: QJCQOQUKCFKWMT-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN4O2 |
|---|---|
| Molecular weight | 273.09 g/mol |
| IUPAC name | 8-bromo-7-ethyl-3-methylpurine-2,6-dione |
| InChIKey | QJCQOQUKCFKWMT-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(N=C1Br)N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)