CAS 10381-82-5 appears in our catalog under these names: 8-Bromo-3,7-Dihydro-1,3,7-Trimethyl-1H-Purine-2,6-Dione, 98%, 98%, 8-Bromo-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
8-bromo-1,3,7-trimethylpurine-2,6-dione (CAS 10381-82-5) is a chemical compound with the molecular formula C8H9BrN4O2 and a molecular weight of 273.09 g/mol. IUPAC name: 8-bromo-1,3,7-trimethylpurine-2,6-dione. InChIKey: YRLRORFORQUTKS-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN4O2 |
|---|---|
| Molecular weight | 273.09 g/mol |
| IUPAC name | 8-bromo-1,3,7-trimethylpurine-2,6-dione |
| InChIKey | YRLRORFORQUTKS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(N=C1Br)N(C(=O)N(C2=O)C)C |
Computed by PubChem (NCBI)