CAS 101079-66-7 is the registry number for 4,5-Dibromothiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,5-dibromothiophene-3-carboxylic acid (CAS 101079-66-7) is a chemical compound with the molecular formula C5H2Br2O2S and a molecular weight of 285.94 g/mol. IUPAC name: 4,5-dibromothiophene-3-carboxylic acid. InChIKey: ARYZJCDPKDFHPT-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2O2S |
|---|---|
| Molecular weight | 285.94 g/mol |
| IUPAC name | 4,5-dibromothiophene-3-carboxylic acid |
| InChIKey | ARYZJCDPKDFHPT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(S1)Br)Br)C(=O)O |
Computed by PubChem (NCBI)