Products 101079-66-7

CAS 101079-66-7 is the registry number for 4,5-Dibromothiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4,5-dibromothiophene-3-carboxylic acid (CAS 101079-66-7) is a chemical compound with the molecular formula C5H2Br2O2S and a molecular weight of 285.94 g/mol. IUPAC name: 4,5-dibromothiophene-3-carboxylic acid. InChIKey: ARYZJCDPKDFHPT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Br2O2S
Molecular weight285.94 g/mol
IUPAC name4,5-dibromothiophene-3-carboxylic acid
InChIKeyARYZJCDPKDFHPT-UHFFFAOYSA-N
SMILESC1=C(C(=C(S1)Br)Br)C(=O)O

Computed by PubChem (NCBI)