Products 7311-68-4

CAS 7311-68-4 appears in our catalog under these names: 3,5-Dibromothiophene-2-carboxylic acid, 3,5-Dibromothiophene-2-carboxylic acid 98%, 3,5-Dibromothiophene-2-carboxylic acid, 97%, 97%, 3,5-Dibromothiophene-2-carboxylic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 25g, 100g.

Structural formula: {0} (CAS {1})

3,5-dibromothiophene-2-carboxylic acid (CAS 7311-68-4) is a chemical compound with the molecular formula C5H2Br2O2S and a molecular weight of 285.94 g/mol. IUPAC name: 3,5-dibromothiophene-2-carboxylic acid. InChIKey: YWOSIPRAZKDEIL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Br2O2S
Molecular weight285.94 g/mol
IUPAC name3,5-dibromothiophene-2-carboxylic acid
InChIKeyYWOSIPRAZKDEIL-UHFFFAOYSA-N
SMILESC1=C(SC(=C1Br)C(=O)O)Br

Computed by PubChem (NCBI)