CAS 10108-87-9 appears in our catalog under these names: Decyltrimethylammonium Chloride, >95% (HPLC), N,N,N–Trimethyldecan–1–aminium chloride, Decyltrimethylammonium Chloride, >98.0%(T), Decyltrimethylammonium chloride, 98%, Decyltrimethylammonium chloride 97%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 500g, 25g, 5g, 10g.
Decyl(trimethyl)azanium chloride (CAS 10108-87-9) is a chemical compound with the molecular formula C13H30ClN and a molecular weight of 235.84 g/mol. IUPAC name: decyl(trimethyl)azanium chloride. InChIKey: HXWGXXDEYMNGCT-UHFFFAOYSA-M.
| Molecular formula | C13H30ClN |
|---|---|
| Molecular weight | 235.84 g/mol |
| IUPAC name | decyl(trimethyl)azanium chloride |
| InChIKey | HXWGXXDEYMNGCT-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCC[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)