Products 10108-87-9

CAS 10108-87-9 appears in our catalog under these names: Decyltrimethylammonium Chloride, >95% (HPLC), N,N,N–Trimethyldecan–1–aminium chloride, Decyltrimethylammonium Chloride, >98.0%(T), Decyltrimethylammonium chloride, 98%, Decyltrimethylammonium chloride 97%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 2,5g, 250mg, 500mg, 100g, 500g, 25g, 5g, 10g.

Structural formula: {0} (CAS {1})

Decyl(trimethyl)azanium chloride (CAS 10108-87-9) is a chemical compound with the molecular formula C13H30ClN and a molecular weight of 235.84 g/mol. IUPAC name: decyl(trimethyl)azanium chloride. InChIKey: HXWGXXDEYMNGCT-UHFFFAOYSA-M.

Identity
Molecular formulaC13H30ClN
Molecular weight235.84 g/mol
IUPAC namedecyl(trimethyl)azanium chloride
InChIKeyHXWGXXDEYMNGCT-UHFFFAOYSA-M
SMILESCCCCCCCCCC[N+](C)(C)C.[Cl-]

Computed by PubChem (NCBI)