CAS 56375-79-2 appears in our catalog under these names: N,N–Dibutyl–N–methylbutan–1–aminium chloride, Methyltri-n-butylammonium chloride, Aliquat 175 (75% aq. sol, Tributylmethylammonium Chloride (ca. 75% in water), Tributylmethylammonium chloride 97%, METHYLTRIBUTYLAMMONIUM CHLORIDE, 75 WT %. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 500g, 100g, 100ml, 500ml, 25g, 1000g, 300g, 1kg.
Tributyl(methyl)azanium chloride (CAS 56375-79-2) is a chemical compound with the molecular formula C13H30ClN and a molecular weight of 235.84 g/mol. IUPAC name: tributyl(methyl)azanium chloride. InChIKey: IPILPUZVTYHGIL-UHFFFAOYSA-M.
| Molecular formula | C13H30ClN |
|---|---|
| Molecular weight | 235.84 g/mol |
| IUPAC name | tributyl(methyl)azanium chloride |
| InChIKey | IPILPUZVTYHGIL-UHFFFAOYSA-M |
| SMILES | CCCC[N+](C)(CCCC)CCCC.[Cl-] |
Computed by PubChem (NCBI)