Products 1010837-60-1
CAS 1010837-60-1 is the registry number for 2-(4-Bromophenyl)-4(5)-(trifluoromethyl)imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-bromophenyl)-5-(trifluoromethyl)-1H-imidazole (CAS 1010837-60-1) is a chemical compound with the molecular formula C10H6BrF3N2 and a molecular weight of 291.07 g/mol. IUPAC name: 2-(4-bromophenyl)-5-(trifluoromethyl)-1H-imidazole. InChIKey: QEUNUPPUTHMOPF-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3N2 |
|---|---|
| Molecular weight | 291.07 g/mol |
| IUPAC name | 2-(4-bromophenyl)-5-(trifluoromethyl)-1H-imidazole |
| InChIKey | QEUNUPPUTHMOPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(N2)C(F)(F)F)Br |
Computed by PubChem (NCBI)