Products 2828438-94-2
CAS 2828438-94-2 is the registry number for 6-Bromo-5-(trifluoromethyl)quinolin-8-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-5-(trifluoromethyl)quinolin-8-amine (CAS 2828438-94-2) is a chemical compound with the molecular formula C10H6BrF3N2 and a molecular weight of 291.07 g/mol. IUPAC name: 6-bromo-5-(trifluoromethyl)quinolin-8-amine. InChIKey: YZCHJXGFBGANIS-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3N2 |
|---|---|
| Molecular weight | 291.07 g/mol |
| IUPAC name | 6-bromo-5-(trifluoromethyl)quinolin-8-amine |
| InChIKey | YZCHJXGFBGANIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CC(=C2C(F)(F)F)Br)N)N=C1 |
Computed by PubChem (NCBI)